C21H17Br2ClN2O2 — CID 126274300
2-[2,6-dibromo-4-[(4-chloroanilino)methyl]phenoxy]-N-phenylacetamide (PubChem CID 126274300) has the molecular formula C21H17Br2ClN2O2 and a molecular weight of 524.64 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(4-chloroanilino)methyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2,6-dibromo-4-[(4-chloroanilino)methyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126274300 |
| Molecular Formula | C21H17Br2ClN2O2 |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 521.93 |
| IUPAC Name | 2-[2,6-dibromo-4-[(4-chloroanilino)methyl]phenoxy]-N-phenylacetamide |
| SMILES | O=C(COc1c(Br)cc(CNc2ccc(Cl)cc2)cc1Br)Nc1ccccc1 |
| InChI | InChI=1S/C21H17Br2ClN2O2/c22-18-10-14(12-25-16-8-6-15(24)7-9-16)11-19(23)21(18)28-13-20(27)26-17-4-2-1-3-5-17/h1-11,25H,12-13H2,(H,26,27) |
| InChIKey | QGADYZXDBXXLNN-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |