C15H11Br2NO3 — CID 4770117
2-(2,4-dibromo-6-formylphenoxy)-N-phenylacetamide (PubChem CID 4770117) has the molecular formula C15H11Br2NO3 and a molecular weight of 413.07 g/mol. Its IUPAC name is 2-(2,4-dibromo-6-formylphenoxy)-N-phenylacetamide.
| Compound Name | 2-(2,4-dibromo-6-formylphenoxy)-N-phenylacetamide |
|---|---|
| PubChem CID | 4770117 |
| Molecular Formula | C15H11Br2NO3 |
| Molecular Weight | 413.07 g/mol |
| Exact Mass | 410.91 |
| IUPAC Name | 2-(2,4-dibromo-6-formylphenoxy)-N-phenylacetamide |
| SMILES | O=Cc1cc(Br)cc(Br)c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H11Br2NO3/c16-11-6-10(8-19)15(13(17)7-11)21-9-14(20)18-12-4-2-1-3-5-12/h1-8H,9H2,(H,18,20) |
| InChIKey | JBBWNVLIDUUPLX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.07 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|