C16H13Br2NO4 — CID 28676661
4-[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]benzoic acid (PubChem CID 28676661) has the molecular formula C16H13Br2NO4 and a molecular weight of 443.09 g/mol. Its IUPAC name is 4-[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 28676661 |
| Molecular Formula | C16H13Br2NO4 |
| Molecular Weight | 443.09 g/mol |
| Exact Mass | 440.92 |
| IUPAC Name | 4-[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]benzoic acid |
| SMILES | Cc1cc(Br)cc(Br)c1OCC(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C16H13Br2NO4/c1-9-6-11(17)7-13(18)15(9)23-8-14(20)19-12-4-2-10(3-5-12)16(21)22/h2-7H,8H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | OBPSNDREXJRUJX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.09 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |