C23H21Br2NO4 — CID 17123513
2-(2,4-dibromo-6-methylphenoxy)-N-[3-(2-phenoxyethoxy)phenyl]acetamide (PubChem CID 17123513) has the molecular formula C23H21Br2NO4 and a molecular weight of 535.23 g/mol. Its IUPAC name is 2-(2,4-dibromo-6-methylphenoxy)-N-[3-(2-phenoxyethoxy)phenyl]acetamide.
| Compound Name | 2-(2,4-dibromo-6-methylphenoxy)-N-[3-(2-phenoxyethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 17123513 |
| Molecular Formula | C23H21Br2NO4 |
| Molecular Weight | 535.23 g/mol |
| Exact Mass | 532.98 |
| IUPAC Name | 2-(2,4-dibromo-6-methylphenoxy)-N-[3-(2-phenoxyethoxy)phenyl]acetamide |
| SMILES | Cc1cc(Br)cc(Br)c1OCC(=O)Nc1cccc(OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C23H21Br2NO4/c1-16-12-17(24)13-21(25)23(16)30-15-22(27)26-18-6-5-9-20(14-18)29-11-10-28-19-7-3-2-4-8-19/h2-9,12-14H,10-11,15H2,1H3,(H,26,27) |
| InChIKey | MTZXRWSTWPBZDR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.23 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|