C22H23BrCl2N2O3S — CID 126261670
2-[2-bromo-6-methoxy-4-(4-methylpiperidine-1-carbothioyl)phenoxy]-N-(2,3-dichlorophenyl)acetamide (PubChem CID 126261670) has the molecular formula C22H23BrCl2N2O3S and a molecular weight of 546.31 g/mol. Its IUPAC name is 2-[2-bromo-6-methoxy-4-(4-methylpiperidine-1-carbothioyl)phenoxy]-N-(2,3-dichlorophenyl)acetamide.
| Compound Name | 2-[2-bromo-6-methoxy-4-(4-methylpiperidine-1-carbothioyl)phenoxy]-N-(2,3-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 126261670 |
| Molecular Formula | C22H23BrCl2N2O3S |
| Molecular Weight | 546.31 g/mol |
| Exact Mass | 544.00 |
| IUPAC Name | 2-[2-bromo-6-methoxy-4-(4-methylpiperidine-1-carbothioyl)phenoxy]-N-(2,3-dichlorophenyl)acetamide |
| SMILES | COc1cc(C(=S)N2CCC(C)CC2)cc(Br)c1OCC(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C22H23BrCl2N2O3S/c1-13-6-8-27(9-7-13)22(31)14-10-15(23)21(18(11-14)29-2)30-12-19(28)26-17-5-3-4-16(24)20(17)25/h3-5,10-11,13H,6-9,12H2,1-2H3,(H,26,28) |
| InChIKey | LDXWGDJNHRFHTD-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.31 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|