C22H25BrClN3O3S — CID 126277280
2-[2-bromo-6-methoxy-4-(4-methylpiperazine-1-carbothioyl)phenoxy]-N-(5-chloro-2-methylphenyl)acetamide (PubChem CID 126277280) has the molecular formula C22H25BrClN3O3S and a molecular weight of 526.88 g/mol. Its IUPAC name is 2-[2-bromo-6-methoxy-4-(4-methylpiperazine-1-carbothioyl)phenoxy]-N-(5-chloro-2-methylphenyl)acetamide.
| Compound Name | 2-[2-bromo-6-methoxy-4-(4-methylpiperazine-1-carbothioyl)phenoxy]-N-(5-chloro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126277280 |
| Molecular Formula | C22H25BrClN3O3S |
| Molecular Weight | 526.88 g/mol |
| Exact Mass | 525.05 |
| IUPAC Name | 2-[2-bromo-6-methoxy-4-(4-methylpiperazine-1-carbothioyl)phenoxy]-N-(5-chloro-2-methylphenyl)acetamide |
| SMILES | COc1cc(C(=S)N2CCN(C)CC2)cc(Br)c1OCC(=O)Nc1cc(Cl)ccc1C |
| InChI | InChI=1S/C22H25BrClN3O3S/c1-14-4-5-16(24)12-18(14)25-20(28)13-30-21-17(23)10-15(11-19(21)29-3)22(31)27-8-6-26(2)7-9-27/h4-5,10-12H,6-9,13H2,1-3H3,(H,25,28) |
| InChIKey | JXTYHVXTDWBPHQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.88 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|