C15H9Cl6NO2 — CID 19178170
N-(5-chloro-2-methylphenyl)-2-(2,3,4,5,6-pentachlorophenoxy)acetamide (PubChem CID 19178170) has the molecular formula C15H9Cl6NO2 and a molecular weight of 447.96 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-(2,3,4,5,6-pentachlorophenoxy)acetamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-(2,3,4,5,6-pentachlorophenoxy)acetamide |
|---|---|
| PubChem CID | 19178170 |
| Molecular Formula | C15H9Cl6NO2 |
| Molecular Weight | 447.96 g/mol |
| Exact Mass | 444.88 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-(2,3,4,5,6-pentachlorophenoxy)acetamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)COc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C15H9Cl6NO2/c1-6-2-3-7(16)4-8(6)22-9(23)5-24-15-13(20)11(18)10(17)12(19)14(15)21/h2-4H,5H2,1H3,(H,22,23) |
| InChIKey | PMNWVPWHNBNRDD-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.96 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|