C14H6Cl7NO2 — CID 19178144
N-(2,4-dichlorophenyl)-2-(2,3,4,5,6-pentachlorophenoxy)acetamide (PubChem CID 19178144) has the molecular formula C14H6Cl7NO2 and a molecular weight of 468.38 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-(2,3,4,5,6-pentachlorophenoxy)acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-(2,3,4,5,6-pentachlorophenoxy)acetamide |
|---|---|
| PubChem CID | 19178144 |
| Molecular Formula | C14H6Cl7NO2 |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 464.82 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-(2,3,4,5,6-pentachlorophenoxy)acetamide |
| SMILES | O=C(COc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H6Cl7NO2/c15-5-1-2-7(6(16)3-5)22-8(23)4-24-14-12(20)10(18)9(17)11(19)13(14)21/h1-3H,4H2,(H,22,23) |
| InChIKey | OCBNPQWFJLJSJL-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|