C16H14BrCl2NO2 — CID 23909609
2-(2-bromo-4,6-dimethylphenoxy)-N-(2,4-dichlorophenyl)acetamide (PubChem CID 23909609) has the molecular formula C16H14BrCl2NO2 and a molecular weight of 403.10 g/mol. Its IUPAC name is 2-(2-bromo-4,6-dimethylphenoxy)-N-(2,4-dichlorophenyl)acetamide.
| Compound Name | 2-(2-bromo-4,6-dimethylphenoxy)-N-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 23909609 |
| Molecular Formula | C16H14BrCl2NO2 |
| Molecular Weight | 403.10 g/mol |
| Exact Mass | 400.96 |
| IUPAC Name | 2-(2-bromo-4,6-dimethylphenoxy)-N-(2,4-dichlorophenyl)acetamide |
| SMILES | Cc1cc(C)c(OCC(=O)Nc2ccc(Cl)cc2Cl)c(Br)c1 |
| InChI | InChI=1S/C16H14BrCl2NO2/c1-9-5-10(2)16(12(17)6-9)22-8-15(21)20-14-4-3-11(18)7-13(14)19/h3-7H,8H2,1-2H3,(H,20,21) |
| InChIKey | NVQIOJSOWYNYOB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.10 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |