C16H12Br2Cl2N2O2S — CID 3382314
2-(2,4-dibromo-6-methylphenoxy)-N-[(2,4-dichlorophenyl)carbamothioyl]acetamide (PubChem CID 3382314) has the molecular formula C16H12Br2Cl2N2O2S and a molecular weight of 527.07 g/mol. Its IUPAC name is 2-(2,4-dibromo-6-methylphenoxy)-N-[(2,4-dichlorophenyl)carbamothioyl]acetamide.
| Compound Name | 2-(2,4-dibromo-6-methylphenoxy)-N-[(2,4-dichlorophenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3382314 |
| Molecular Formula | C16H12Br2Cl2N2O2S |
| Molecular Weight | 527.07 g/mol |
| Exact Mass | 523.84 |
| IUPAC Name | 2-(2,4-dibromo-6-methylphenoxy)-N-[(2,4-dichlorophenyl)carbamothioyl]acetamide |
| SMILES | Cc1cc(Br)cc(Br)c1OCC(=O)NC(=S)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H12Br2Cl2N2O2S/c1-8-4-9(17)5-11(18)15(8)24-7-14(23)22-16(25)21-13-3-2-10(19)6-12(13)20/h2-6H,7H2,1H3,(H2,21,22,23,25) |
| InChIKey | UGYRBUCYWPLATE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.07 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|