C14H18Br2N2O2S — CID 3362713
N-(tert-butylcarbamothioyl)-2-(2,4-dibromo-6-methylphenoxy)acetamide (PubChem CID 3362713) has the molecular formula C14H18Br2N2O2S and a molecular weight of 438.19 g/mol. Its IUPAC name is N-(tert-butylcarbamothioyl)-2-(2,4-dibromo-6-methylphenoxy)acetamide.
| Compound Name | N-(tert-butylcarbamothioyl)-2-(2,4-dibromo-6-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 3362713 |
| Molecular Formula | C14H18Br2N2O2S |
| Molecular Weight | 438.19 g/mol |
| Exact Mass | 435.95 |
| IUPAC Name | N-(tert-butylcarbamothioyl)-2-(2,4-dibromo-6-methylphenoxy)acetamide |
| SMILES | Cc1cc(Br)cc(Br)c1OCC(=O)NC(=S)NC(C)(C)C |
| InChI | InChI=1S/C14H18Br2N2O2S/c1-8-5-9(15)6-10(16)12(8)20-7-11(19)17-13(21)18-14(2,3)4/h5-6H,7H2,1-4H3,(H2,17,18,19,21) |
| InChIKey | OOVDCLQMHIBHRW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.19 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|