C17H14Br2N4O5S — CID 4509477
2-(2,4-dibromo-6-methylphenoxy)-N-[[(2-nitrobenzoyl)amino]carbamothioyl]acetamide (PubChem CID 4509477) has the molecular formula C17H14Br2N4O5S and a molecular weight of 546.20 g/mol. Its IUPAC name is 2-(2,4-dibromo-6-methylphenoxy)-N-[[(2-nitrobenzoyl)amino]carbamothioyl]acetamide.
| Compound Name | 2-(2,4-dibromo-6-methylphenoxy)-N-[[(2-nitrobenzoyl)amino]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 4509477 |
| Molecular Formula | C17H14Br2N4O5S |
| Molecular Weight | 546.20 g/mol |
| Exact Mass | 543.91 |
| IUPAC Name | 2-(2,4-dibromo-6-methylphenoxy)-N-[[(2-nitrobenzoyl)amino]carbamothioyl]acetamide |
| SMILES | Cc1cc(Br)cc(Br)c1OCC(=O)NC(=S)NNC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14Br2N4O5S/c1-9-6-10(18)7-12(19)15(9)28-8-14(24)20-17(29)22-21-16(25)11-4-2-3-5-13(11)23(26)27/h2-7H,8H2,1H3,(H,21,25)(H2,20,22,24,29) |
| InChIKey | IVBXUJQLGMQNTC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.20 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|