C19H19BrN4O5S — CID 17051292
5-bromo-2-(2-methylpropoxy)-N-[[(2-nitrobenzoyl)amino]carbamothioyl]benzamide (PubChem CID 17051292) has the molecular formula C19H19BrN4O5S and a molecular weight of 495.36 g/mol. Its IUPAC name is 5-bromo-2-(2-methylpropoxy)-N-[[(2-nitrobenzoyl)amino]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-(2-methylpropoxy)-N-[[(2-nitrobenzoyl)amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17051292 |
| Molecular Formula | C19H19BrN4O5S |
| Molecular Weight | 495.36 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | 5-bromo-2-(2-methylpropoxy)-N-[[(2-nitrobenzoyl)amino]carbamothioyl]benzamide |
| SMILES | CC(C)COc1ccc(Br)cc1C(=O)NC(=S)NNC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19BrN4O5S/c1-11(2)10-29-16-8-7-12(20)9-14(16)17(25)21-19(30)23-22-18(26)13-5-3-4-6-15(13)24(27)28/h3-9,11H,10H2,1-2H3,(H,22,26)(H2,21,23,25,30) |
| InChIKey | IJDKHYPRPYHZAB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|