C19H20BrN3O4S — CID 17051240
5-bromo-N-[(4-methyl-3-nitrophenyl)carbamothioyl]-2-(2-methylpropoxy)benzamide (PubChem CID 17051240) has the molecular formula C19H20BrN3O4S and a molecular weight of 466.36 g/mol. Its IUPAC name is 5-bromo-N-[(4-methyl-3-nitrophenyl)carbamothioyl]-2-(2-methylpropoxy)benzamide.
| Compound Name | 5-bromo-N-[(4-methyl-3-nitrophenyl)carbamothioyl]-2-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 17051240 |
| Molecular Formula | C19H20BrN3O4S |
| Molecular Weight | 466.36 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | 5-bromo-N-[(4-methyl-3-nitrophenyl)carbamothioyl]-2-(2-methylpropoxy)benzamide |
| SMILES | Cc1ccc(NC(=S)NC(=O)c2cc(Br)ccc2OCC(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20BrN3O4S/c1-11(2)10-27-17-7-5-13(20)8-15(17)18(24)22-19(28)21-14-6-4-12(3)16(9-14)23(25)26/h4-9,11H,10H2,1-3H3,(H2,21,22,24,28) |
| InChIKey | HEEYUOGPZKKWFV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.36 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|