C19H20Br2N2O2S — CID 54784785
5-bromo-N-[(2-bromo-4-methylphenyl)carbamothioyl]-2-(2-methylpropoxy)benzamide (PubChem CID 54784785) has the molecular formula C19H20Br2N2O2S and a molecular weight of 500.26 g/mol. Its IUPAC name is 5-bromo-N-[(2-bromo-4-methylphenyl)carbamothioyl]-2-(2-methylpropoxy)benzamide.
| Compound Name | 5-bromo-N-[(2-bromo-4-methylphenyl)carbamothioyl]-2-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 54784785 |
| Molecular Formula | C19H20Br2N2O2S |
| Molecular Weight | 500.26 g/mol |
| Exact Mass | 497.96 |
| IUPAC Name | 5-bromo-N-[(2-bromo-4-methylphenyl)carbamothioyl]-2-(2-methylpropoxy)benzamide |
| SMILES | Cc1ccc(NC(=S)NC(=O)c2cc(Br)ccc2OCC(C)C)c(Br)c1 |
| InChI | InChI=1S/C19H20Br2N2O2S/c1-11(2)10-25-17-7-5-13(20)9-14(17)18(24)23-19(26)22-16-6-4-12(3)8-15(16)21/h4-9,11H,10H2,1-3H3,(H2,22,23,24,26) |
| InChIKey | CTGJDQCUUDDQGW-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.26 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|