C18H17BrCl2N2O2S — CID 54786230
5-bromo-N-[(2,6-dichlorophenyl)carbamothioyl]-2-(2-methylpropoxy)benzamide (PubChem CID 54786230) has the molecular formula C18H17BrCl2N2O2S and a molecular weight of 476.22 g/mol. Its IUPAC name is 5-bromo-N-[(2,6-dichlorophenyl)carbamothioyl]-2-(2-methylpropoxy)benzamide.
| Compound Name | 5-bromo-N-[(2,6-dichlorophenyl)carbamothioyl]-2-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 54786230 |
| Molecular Formula | C18H17BrCl2N2O2S |
| Molecular Weight | 476.22 g/mol |
| Exact Mass | 473.96 |
| IUPAC Name | 5-bromo-N-[(2,6-dichlorophenyl)carbamothioyl]-2-(2-methylpropoxy)benzamide |
| SMILES | CC(C)COc1ccc(Br)cc1C(=O)NC(=S)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H17BrCl2N2O2S/c1-10(2)9-25-15-7-6-11(19)8-12(15)17(24)23-18(26)22-16-13(20)4-3-5-14(16)21/h3-8,10H,9H2,1-2H3,(H2,22,23,24,26) |
| InChIKey | OSOARTGPYLCSHQ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.22 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|