C27H27BrN4O4S — CID 17051325
5-bromo-N-[[[4-[(2-methylbenzoyl)amino]benzoyl]amino]carbamothioyl]-2-(2-methylpropoxy)benzamide (PubChem CID 17051325) has the molecular formula C27H27BrN4O4S and a molecular weight of 583.51 g/mol. Its IUPAC name is 5-bromo-N-[[[4-[(2-methylbenzoyl)amino]benzoyl]amino]carbamothioyl]-2-(2-methylpropoxy)benzamide.
| Compound Name | 5-bromo-N-[[[4-[(2-methylbenzoyl)amino]benzoyl]amino]carbamothioyl]-2-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 17051325 |
| Molecular Formula | C27H27BrN4O4S |
| Molecular Weight | 583.51 g/mol |
| Exact Mass | 582.09 |
| IUPAC Name | 5-bromo-N-[[[4-[(2-methylbenzoyl)amino]benzoyl]amino]carbamothioyl]-2-(2-methylpropoxy)benzamide |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(C(=O)NNC(=S)NC(=O)c2cc(Br)ccc2OCC(C)C)cc1 |
| InChI | InChI=1S/C27H27BrN4O4S/c1-16(2)15-36-23-13-10-19(28)14-22(23)26(35)30-27(37)32-31-24(33)18-8-11-20(12-9-18)29-25(34)21-7-5-4-6-17(21)3/h4-14,16H,15H2,1-3H3,(H,29,34)(H,31,33)(H2,30,32,35,37) |
| InChIKey | VHXYGNUIIVBQTC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|