C17H16BrN3O5 — CID 17351738
5-bromo-N'-(2-nitrobenzoyl)-2-propoxybenzohydrazide (PubChem CID 17351738) has the molecular formula C17H16BrN3O5 and a molecular weight of 422.24 g/mol. Its IUPAC name is 5-bromo-N'-(2-nitrobenzoyl)-2-propoxybenzohydrazide.
| Compound Name | 5-bromo-N'-(2-nitrobenzoyl)-2-propoxybenzohydrazide |
|---|---|
| PubChem CID | 17351738 |
| Molecular Formula | C17H16BrN3O5 |
| Molecular Weight | 422.24 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | 5-bromo-N'-(2-nitrobenzoyl)-2-propoxybenzohydrazide |
| SMILES | CCCOc1ccc(Br)cc1C(=O)NNC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16BrN3O5/c1-2-9-26-15-8-7-11(18)10-13(15)17(23)20-19-16(22)12-5-3-4-6-14(12)21(24)25/h3-8,10H,2,9H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | BKBPUQRVLFUJAI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|