C17H15BrN4O5S — CID 3484475
N-[[[2-(4-bromo-3-methylphenoxy)acetyl]amino]carbamothioyl]-2-nitrobenzamide (PubChem CID 3484475) has the molecular formula C17H15BrN4O5S and a molecular weight of 467.30 g/mol. Its IUPAC name is N-[[[2-(4-bromo-3-methylphenoxy)acetyl]amino]carbamothioyl]-2-nitrobenzamide.
| Compound Name | N-[[[2-(4-bromo-3-methylphenoxy)acetyl]amino]carbamothioyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 3484475 |
| Molecular Formula | C17H15BrN4O5S |
| Molecular Weight | 467.30 g/mol |
| Exact Mass | 465.99 |
| IUPAC Name | N-[[[2-(4-bromo-3-methylphenoxy)acetyl]amino]carbamothioyl]-2-nitrobenzamide |
| SMILES | Cc1cc(OCC(=O)NNC(=S)NC(=O)c2ccccc2[N+](=O)[O-])ccc1Br |
| InChI | InChI=1S/C17H15BrN4O5S/c1-10-8-11(6-7-13(10)18)27-9-15(23)20-21-17(28)19-16(24)12-4-2-3-5-14(12)22(25)26/h2-8H,9H2,1H3,(H,20,23)(H2,19,21,24,28) |
| InChIKey | DJAQDWITPUSXHW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|