C20H22N4O5S — CID 4923804
N-[[[2-(4-butan-2-ylphenoxy)acetyl]amino]carbamothioyl]-2-nitrobenzamide (PubChem CID 4923804) has the molecular formula C20H22N4O5S and a molecular weight of 430.49 g/mol. Its IUPAC name is N-[[[2-(4-butan-2-ylphenoxy)acetyl]amino]carbamothioyl]-2-nitrobenzamide.
| Compound Name | N-[[[2-(4-butan-2-ylphenoxy)acetyl]amino]carbamothioyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 4923804 |
| Molecular Formula | C20H22N4O5S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | N-[[[2-(4-butan-2-ylphenoxy)acetyl]amino]carbamothioyl]-2-nitrobenzamide |
| SMILES | CCC(C)c1ccc(OCC(=O)NNC(=S)NC(=O)c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H22N4O5S/c1-3-13(2)14-8-10-15(11-9-14)29-12-18(25)22-23-20(30)21-19(26)16-6-4-5-7-17(16)24(27)28/h4-11,13H,3,12H2,1-2H3,(H,22,25)(H2,21,23,26,30) |
| InChIKey | WUWCKFUOKLTWIQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|