About 2-nitro-N'-[2-(4-phenylphenoxy)acetyl]benzohydrazide
2-nitro-N'-[2-(4-phenylphenoxy)acetyl]benzohydrazide (PubChem CID 4512739) has the molecular formula C21H17N3O5
and a molecular weight of 391.38 g/mol. Its IUPAC name is 2-nitro-N'-[2-(4-phenylphenoxy)acetyl]benzohydrazide.
Molecular Properties
| Compound Name | 2-nitro-N'-[2-(4-phenylphenoxy)acetyl]benzohydrazide |
| PubChem CID | 4512739 |
| Molecular Formula | C21H17N3O5 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2-nitro-N'-[2-(4-phenylphenoxy)acetyl]benzohydrazide |
| SMILES | O=C(COc1ccc(-c2ccccc2)cc1)NNC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H17N3O5/c25-20(22-23-21(26)18-8-4-5-9-19(18)24(27)28)14-29-17-12-10-16(11-13-17)15-6-2-1-3-7-15/h1-13H,14H2,(H,22,25)(H,23,26) |
| InChIKey | PFHXGMUQIIQBKT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-N'-[2-(4-phenylphenoxy)acetyl]benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-N'-[2-(4-phenylphenoxy)acetyl]benzohydrazide?
The IUPAC name of 2-nitro-N'-[2-(4-phenylphenoxy)acetyl]benzohydrazide (CID 4512739) is 2-nitro-N'-[2-(4-phenylphenoxy)acetyl]benzohydrazide.
What is the SMILES notation for 2-nitro-N'-[2-(4-phenylphenoxy)acetyl]benzohydrazide?
The canonical SMILES for 2-nitro-N'-[2-(4-phenylphenoxy)acetyl]benzohydrazide is O=C(COc1ccc(-c2ccccc2)cc1)NNC(=O)c1ccccc1[N+](=O)[O-].
What is the InChIKey of 2-nitro-N'-[2-(4-phenylphenoxy)acetyl]benzohydrazide?
The InChIKey is PFHXGMUQIIQBKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3O5/c25-20(22-23-21(26)18-8-4-5-9-19(18)24(27)28)14-29-17-12-10-16(11-13-17)15-6-2-1-3-7-15/h1-13H,14H2,(H,22,25)(H,23,26).
What are the key properties of 2-nitro-N'-[2-(4-phenylphenoxy)acetyl]benzohydrazide?
2-nitro-N'-[2-(4-phenylphenoxy)acetyl]benzohydrazide has a molecular weight of 391.38 g/mol, XLogP of 3.10, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-N'-[2-(4-phenylphenoxy)acetyl]benzohydrazide is sourced from PubChem (CID 4512739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).