C16H19Br2N3O5S — CID 4502844
ethyl 4-[[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate (PubChem CID 4502844) has the molecular formula C16H19Br2N3O5S and a molecular weight of 525.22 g/mol. Its IUPAC name is ethyl 4-[[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate.
| Compound Name | ethyl 4-[[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4502844 |
| Molecular Formula | C16H19Br2N3O5S |
| Molecular Weight | 525.22 g/mol |
| Exact Mass | 522.94 |
| IUPAC Name | ethyl 4-[[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)NC(=S)NNC(=O)COc1c(C)cc(Br)cc1Br |
| InChI | InChI=1S/C16H19Br2N3O5S/c1-3-25-14(24)5-4-12(22)19-16(27)21-20-13(23)8-26-15-9(2)6-10(17)7-11(15)18/h6-7H,3-5,8H2,1-2H3,(H,20,23)(H2,19,21,22,27) |
| InChIKey | QPWGJAALBGHXFB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|