C16H19Br2N3O6S — CID 17338975
2-methoxyethyl 4-[[[2-(2,4-dibromophenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate (PubChem CID 17338975) has the molecular formula C16H19Br2N3O6S and a molecular weight of 541.22 g/mol. Its IUPAC name is 2-methoxyethyl 4-[[[2-(2,4-dibromophenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate.
| Compound Name | 2-methoxyethyl 4-[[[2-(2,4-dibromophenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 17338975 |
| Molecular Formula | C16H19Br2N3O6S |
| Molecular Weight | 541.22 g/mol |
| Exact Mass | 538.94 |
| IUPAC Name | 2-methoxyethyl 4-[[[2-(2,4-dibromophenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate |
| SMILES | COCCOC(=O)CCC(=O)NC(=S)NNC(=O)COc1ccc(Br)cc1Br |
| InChI | InChI=1S/C16H19Br2N3O6S/c1-25-6-7-26-15(24)5-4-13(22)19-16(28)21-20-14(23)9-27-12-3-2-10(17)8-11(12)18/h2-3,8H,4-7,9H2,1H3,(H,20,23)(H2,19,21,22,28) |
| InChIKey | WGKBDTMRNZXEOX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|