C19H26BrN3O6S — CID 17338999
2-methoxyethyl 4-[[[2-(2-bromo-4-propan-2-ylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate (PubChem CID 17338999) has the molecular formula C19H26BrN3O6S and a molecular weight of 504.40 g/mol. Its IUPAC name is 2-methoxyethyl 4-[[[2-(2-bromo-4-propan-2-ylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate.
| Compound Name | 2-methoxyethyl 4-[[[2-(2-bromo-4-propan-2-ylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 17338999 |
| Molecular Formula | C19H26BrN3O6S |
| Molecular Weight | 504.40 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | 2-methoxyethyl 4-[[[2-(2-bromo-4-propan-2-ylphenoxy)acetyl]amino]carbamothioylamino]-4-oxobutanoate |
| SMILES | COCCOC(=O)CCC(=O)NC(=S)NNC(=O)COc1ccc(C(C)C)cc1Br |
| InChI | InChI=1S/C19H26BrN3O6S/c1-12(2)13-4-5-15(14(20)10-13)29-11-17(25)22-23-19(30)21-16(24)6-7-18(26)28-9-8-27-3/h4-5,10,12H,6-9,11H2,1-3H3,(H,22,25)(H2,21,23,24,30) |
| InChIKey | CIKVTNQMPHFDMY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|