C9H7Br2O3- — CID 6921474
2-(2,4-dibromo-6-methylphenoxy)acetate (PubChem CID 6921474) has the molecular formula C9H7Br2O3- and a molecular weight of 322.96 g/mol. Its IUPAC name is 2-(2,4-dibromo-6-methylphenoxy)acetate.
| Compound Name | 2-(2,4-dibromo-6-methylphenoxy)acetate |
|---|---|
| PubChem CID | 6921474 |
| Molecular Formula | C9H7Br2O3- |
| Molecular Weight | 322.96 g/mol |
| Exact Mass | 320.88 |
| IUPAC Name | 2-(2,4-dibromo-6-methylphenoxy)acetate |
| SMILES | Cc1cc(Br)cc(Br)c1OCC(=O)[O-] |
| InChI | InChI=1S/C9H8Br2O3/c1-5-2-6(10)3-7(11)9(5)14-4-8(12)13/h2-3H,4H2,1H3,(H,12,13)/p-1 |
| InChIKey | ONPBJJDXODEHDD-UHFFFAOYSA-M |
| XLogP | 1.65 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.96 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |