C16H13Br2ClO3 — CID 23011020
(3-chloro-4-methylphenyl) 2-(2,4-dibromo-6-methylphenoxy)acetate (PubChem CID 23011020) has the molecular formula C16H13Br2ClO3 and a molecular weight of 448.54 g/mol. Its IUPAC name is (3-chloro-4-methylphenyl) 2-(2,4-dibromo-6-methylphenoxy)acetate.
| Compound Name | (3-chloro-4-methylphenyl) 2-(2,4-dibromo-6-methylphenoxy)acetate |
|---|---|
| PubChem CID | 23011020 |
| Molecular Formula | C16H13Br2ClO3 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 445.89 |
| IUPAC Name | (3-chloro-4-methylphenyl) 2-(2,4-dibromo-6-methylphenoxy)acetate |
| SMILES | Cc1ccc(OC(=O)COc2c(C)cc(Br)cc2Br)cc1Cl |
| InChI | InChI=1S/C16H13Br2ClO3/c1-9-3-4-12(7-14(9)19)22-15(20)8-21-16-10(2)5-11(17)6-13(16)18/h3-7H,8H2,1-2H3 |
| InChIKey | SVMDFJFZPDXIGT-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|