C17H16Br2O3 — CID 23011169
(4-bromo-2-methylphenyl) 2-(4-bromo-2,6-dimethylphenoxy)acetate (PubChem CID 23011169) has the molecular formula C17H16Br2O3 and a molecular weight of 428.12 g/mol. Its IUPAC name is (4-bromo-2-methylphenyl) 2-(4-bromo-2,6-dimethylphenoxy)acetate.
| Compound Name | (4-bromo-2-methylphenyl) 2-(4-bromo-2,6-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 23011169 |
| Molecular Formula | C17H16Br2O3 |
| Molecular Weight | 428.12 g/mol |
| Exact Mass | 425.95 |
| IUPAC Name | (4-bromo-2-methylphenyl) 2-(4-bromo-2,6-dimethylphenoxy)acetate |
| SMILES | Cc1cc(Br)ccc1OC(=O)COc1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C17H16Br2O3/c1-10-6-13(18)4-5-15(10)22-16(20)9-21-17-11(2)7-14(19)8-12(17)3/h4-8H,9H2,1-3H3 |
| InChIKey | NJFJJAQNNWILKL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.12 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|