C16H14BrClO3 — CID 23011161
(2,5-dimethylphenyl) 2-(4-bromo-2-chlorophenoxy)acetate (PubChem CID 23011161) has the molecular formula C16H14BrClO3 and a molecular weight of 369.64 g/mol. Its IUPAC name is (2,5-dimethylphenyl) 2-(4-bromo-2-chlorophenoxy)acetate.
| Compound Name | (2,5-dimethylphenyl) 2-(4-bromo-2-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 23011161 |
| Molecular Formula | C16H14BrClO3 |
| Molecular Weight | 369.64 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | (2,5-dimethylphenyl) 2-(4-bromo-2-chlorophenoxy)acetate |
| SMILES | Cc1ccc(C)c(OC(=O)COc2ccc(Br)cc2Cl)c1 |
| InChI | InChI=1S/C16H14BrClO3/c1-10-3-4-11(2)15(7-10)21-16(19)9-20-14-6-5-12(17)8-13(14)18/h3-8H,9H2,1-2H3 |
| InChIKey | JUHMNYQCPXTFLB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.64 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|