C19H21BrO3 — CID 17188151
(4-bromo-2-propan-2-ylphenyl) 2-(2,5-dimethylphenoxy)acetate (PubChem CID 17188151) has the molecular formula C19H21BrO3 and a molecular weight of 377.28 g/mol. Its IUPAC name is (4-bromo-2-propan-2-ylphenyl) 2-(2,5-dimethylphenoxy)acetate.
| Compound Name | (4-bromo-2-propan-2-ylphenyl) 2-(2,5-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 17188151 |
| Molecular Formula | C19H21BrO3 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | (4-bromo-2-propan-2-ylphenyl) 2-(2,5-dimethylphenoxy)acetate |
| SMILES | Cc1ccc(C)c(OCC(=O)Oc2ccc(Br)cc2C(C)C)c1 |
| InChI | InChI=1S/C19H21BrO3/c1-12(2)16-10-15(20)7-8-17(16)23-19(21)11-22-18-9-13(3)5-6-14(18)4/h5-10,12H,11H2,1-4H3 |
| InChIKey | LTVJGGQQTBOUMM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|