C18H18Br2O3 — CID 23011034
(2-propan-2-ylphenyl) 2-(2,4-dibromo-6-methylphenoxy)acetate (PubChem CID 23011034) has the molecular formula C18H18Br2O3 and a molecular weight of 442.15 g/mol. Its IUPAC name is (2-propan-2-ylphenyl) 2-(2,4-dibromo-6-methylphenoxy)acetate.
| Compound Name | (2-propan-2-ylphenyl) 2-(2,4-dibromo-6-methylphenoxy)acetate |
|---|---|
| PubChem CID | 23011034 |
| Molecular Formula | C18H18Br2O3 |
| Molecular Weight | 442.15 g/mol |
| Exact Mass | 439.96 |
| IUPAC Name | (2-propan-2-ylphenyl) 2-(2,4-dibromo-6-methylphenoxy)acetate |
| SMILES | Cc1cc(Br)cc(Br)c1OCC(=O)Oc1ccccc1C(C)C |
| InChI | InChI=1S/C18H18Br2O3/c1-11(2)14-6-4-5-7-16(14)23-17(21)10-22-18-12(3)8-13(19)9-15(18)20/h4-9,11H,10H2,1-3H3 |
| InChIKey | BKJGGDPMDBXQEW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.15 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|