C21H15Br3O3 — CID 23012561
(2,4-dibromo-6-methylphenyl) 2-(2-bromo-4-phenylphenoxy)acetate (PubChem CID 23012561) has the molecular formula C21H15Br3O3 and a molecular weight of 555.06 g/mol. Its IUPAC name is (2,4-dibromo-6-methylphenyl) 2-(2-bromo-4-phenylphenoxy)acetate.
| Compound Name | (2,4-dibromo-6-methylphenyl) 2-(2-bromo-4-phenylphenoxy)acetate |
|---|---|
| PubChem CID | 23012561 |
| Molecular Formula | C21H15Br3O3 |
| Molecular Weight | 555.06 g/mol |
| Exact Mass | 551.86 |
| IUPAC Name | (2,4-dibromo-6-methylphenyl) 2-(2-bromo-4-phenylphenoxy)acetate |
| SMILES | Cc1cc(Br)cc(Br)c1OC(=O)COc1ccc(-c2ccccc2)cc1Br |
| InChI | InChI=1S/C21H15Br3O3/c1-13-9-16(22)11-18(24)21(13)27-20(25)12-26-19-8-7-15(10-17(19)23)14-5-3-2-4-6-14/h2-11H,12H2,1H3 |
| InChIKey | MMGOYGYMGRLVCY-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.06 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|