C20H13Br3O3 — CID 23012557
(2,4-dibromophenyl) 2-(2-bromo-4-phenylphenoxy)acetate (PubChem CID 23012557) has the molecular formula C20H13Br3O3 and a molecular weight of 541.03 g/mol. Its IUPAC name is (2,4-dibromophenyl) 2-(2-bromo-4-phenylphenoxy)acetate.
| Compound Name | (2,4-dibromophenyl) 2-(2-bromo-4-phenylphenoxy)acetate |
|---|---|
| PubChem CID | 23012557 |
| Molecular Formula | C20H13Br3O3 |
| Molecular Weight | 541.03 g/mol |
| Exact Mass | 537.84 |
| IUPAC Name | (2,4-dibromophenyl) 2-(2-bromo-4-phenylphenoxy)acetate |
| SMILES | O=C(COc1ccc(-c2ccccc2)cc1Br)Oc1ccc(Br)cc1Br |
| InChI | InChI=1S/C20H13Br3O3/c21-15-7-9-19(17(23)11-15)26-20(24)12-25-18-8-6-14(10-16(18)22)13-4-2-1-3-5-13/h1-11H,12H2 |
| InChIKey | CWSVKLCBVXDPCL-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.03 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|