C15H9Br3O5 — CID 54854409
5-bromo-2-[2-(2,4-dibromophenoxy)acetyl]oxybenzoic acid (PubChem CID 54854409) has the molecular formula C15H9Br3O5 and a molecular weight of 508.94 g/mol. Its IUPAC name is 5-bromo-2-[2-(2,4-dibromophenoxy)acetyl]oxybenzoic acid.
| Compound Name | 5-bromo-2-[2-(2,4-dibromophenoxy)acetyl]oxybenzoic acid |
|---|---|
| PubChem CID | 54854409 |
| Molecular Formula | C15H9Br3O5 |
| Molecular Weight | 508.94 g/mol |
| Exact Mass | 505.80 |
| IUPAC Name | 5-bromo-2-[2-(2,4-dibromophenoxy)acetyl]oxybenzoic acid |
| SMILES | O=C(COc1ccc(Br)cc1Br)Oc1ccc(Br)cc1C(=O)O |
| InChI | InChI=1S/C15H9Br3O5/c16-8-1-3-12(10(5-8)15(20)21)23-14(19)7-22-13-4-2-9(17)6-11(13)18/h1-6H,7H2,(H,20,21) |
| InChIKey | HPZONYZNMKRXSP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.94 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|