C16H20Br2N2O2S — CID 3362720
N-(azepane-1-carbothioyl)-2-(2,4-dibromo-6-methylphenoxy)acetamide (PubChem CID 3362720) has the molecular formula C16H20Br2N2O2S and a molecular weight of 464.22 g/mol. Its IUPAC name is N-(azepane-1-carbothioyl)-2-(2,4-dibromo-6-methylphenoxy)acetamide.
| Compound Name | N-(azepane-1-carbothioyl)-2-(2,4-dibromo-6-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 3362720 |
| Molecular Formula | C16H20Br2N2O2S |
| Molecular Weight | 464.22 g/mol |
| Exact Mass | 461.96 |
| IUPAC Name | N-(azepane-1-carbothioyl)-2-(2,4-dibromo-6-methylphenoxy)acetamide |
| SMILES | Cc1cc(Br)cc(Br)c1OCC(=O)NC(=S)N1CCCCCC1 |
| InChI | InChI=1S/C16H20Br2N2O2S/c1-11-8-12(17)9-13(18)15(11)22-10-14(21)19-16(23)20-6-4-2-3-5-7-20/h8-9H,2-7,10H2,1H3,(H,19,21,23) |
| InChIKey | FDQOGFBNYHCGPQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.22 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|