C18H18Br2N2O2S — CID 3326021
2-(2,4-dibromo-6-methylphenoxy)-N-[ethyl(phenyl)carbamothioyl]acetamide (PubChem CID 3326021) has the molecular formula C18H18Br2N2O2S and a molecular weight of 486.23 g/mol. Its IUPAC name is 2-(2,4-dibromo-6-methylphenoxy)-N-[ethyl(phenyl)carbamothioyl]acetamide.
| Compound Name | 2-(2,4-dibromo-6-methylphenoxy)-N-[ethyl(phenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3326021 |
| Molecular Formula | C18H18Br2N2O2S |
| Molecular Weight | 486.23 g/mol |
| Exact Mass | 483.95 |
| IUPAC Name | 2-(2,4-dibromo-6-methylphenoxy)-N-[ethyl(phenyl)carbamothioyl]acetamide |
| SMILES | CCN(C(=S)NC(=O)COc1c(C)cc(Br)cc1Br)c1ccccc1 |
| InChI | InChI=1S/C18H18Br2N2O2S/c1-3-22(14-7-5-4-6-8-14)18(25)21-16(23)11-24-17-12(2)9-13(19)10-15(17)20/h4-10H,3,11H2,1-2H3,(H,21,23,25) |
| InChIKey | XSBAGZAGBGKXTF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.23 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|