C24H22Br2N2O3 — CID 17186649
2-[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]-N-ethyl-N-phenylbenzamide (PubChem CID 17186649) has the molecular formula C24H22Br2N2O3 and a molecular weight of 546.26 g/mol. Its IUPAC name is 2-[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]-N-ethyl-N-phenylbenzamide.
| Compound Name | 2-[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]-N-ethyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 17186649 |
| Molecular Formula | C24H22Br2N2O3 |
| Molecular Weight | 546.26 g/mol |
| Exact Mass | 544.00 |
| IUPAC Name | 2-[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]-N-ethyl-N-phenylbenzamide |
| SMILES | CCN(C(=O)c1ccccc1NC(=O)COc1c(C)cc(Br)cc1Br)c1ccccc1 |
| InChI | InChI=1S/C24H22Br2N2O3/c1-3-28(18-9-5-4-6-10-18)24(30)19-11-7-8-12-21(19)27-22(29)15-31-23-16(2)13-17(25)14-20(23)26/h4-14H,3,15H2,1-2H3,(H,27,29) |
| InChIKey | ZUWSRGLJUIVEJV-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.26 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |