C23H20Cl2N2O3 — CID 17186619
2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-N-ethyl-N-phenylbenzamide (PubChem CID 17186619) has the molecular formula C23H20Cl2N2O3 and a molecular weight of 443.33 g/mol. Its IUPAC name is 2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-N-ethyl-N-phenylbenzamide.
| Compound Name | 2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-N-ethyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 17186619 |
| Molecular Formula | C23H20Cl2N2O3 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-N-ethyl-N-phenylbenzamide |
| SMILES | CCN(C(=O)c1ccccc1NC(=O)COc1ccc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C23H20Cl2N2O3/c1-2-27(17-8-4-3-5-9-17)23(29)18-10-6-7-11-20(18)26-22(28)15-30-21-13-12-16(24)14-19(21)25/h3-14H,2,15H2,1H3,(H,26,28) |
| InChIKey | XDIKPVMYFHUEFL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |