C20H22Br2N2O3 — CID 17151209
N-butan-2-yl-2-[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]benzamide (PubChem CID 17151209) has the molecular formula C20H22Br2N2O3 and a molecular weight of 498.22 g/mol. Its IUPAC name is N-butan-2-yl-2-[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]benzamide.
| Compound Name | N-butan-2-yl-2-[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 17151209 |
| Molecular Formula | C20H22Br2N2O3 |
| Molecular Weight | 498.22 g/mol |
| Exact Mass | 496.00 |
| IUPAC Name | N-butan-2-yl-2-[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]benzamide |
| SMILES | CCC(C)NC(=O)c1ccccc1NC(=O)COc1c(C)cc(Br)cc1Br |
| InChI | InChI=1S/C20H22Br2N2O3/c1-4-13(3)23-20(26)15-7-5-6-8-17(15)24-18(25)11-27-19-12(2)9-14(21)10-16(19)22/h5-10,13H,4,11H2,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | JDRROSWCWGVJSH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.22 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |