C21H26N2O3 — CID 17151213
N-butan-2-yl-2-[[2-(2,5-dimethylphenoxy)acetyl]amino]benzamide (PubChem CID 17151213) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-butan-2-yl-2-[[2-(2,5-dimethylphenoxy)acetyl]amino]benzamide.
| Compound Name | N-butan-2-yl-2-[[2-(2,5-dimethylphenoxy)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 17151213 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-butan-2-yl-2-[[2-(2,5-dimethylphenoxy)acetyl]amino]benzamide |
| SMILES | CCC(C)NC(=O)c1ccccc1NC(=O)COc1cc(C)ccc1C |
| InChI | InChI=1S/C21H26N2O3/c1-5-16(4)22-21(25)17-8-6-7-9-18(17)23-20(24)13-26-19-12-14(2)10-11-15(19)3/h6-12,16H,5,13H2,1-4H3,(H,22,25)(H,23,24) |
| InChIKey | KZBHECYUYYTOLZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |