C27H38N2O3 — CID 17151289
N-butan-2-yl-2-[[2-(2,4-ditert-butylphenoxy)acetyl]amino]benzamide (PubChem CID 17151289) has the molecular formula C27H38N2O3 and a molecular weight of 438.61 g/mol. Its IUPAC name is N-butan-2-yl-2-[[2-(2,4-ditert-butylphenoxy)acetyl]amino]benzamide.
| Compound Name | N-butan-2-yl-2-[[2-(2,4-ditert-butylphenoxy)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 17151289 |
| Molecular Formula | C27H38N2O3 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | N-butan-2-yl-2-[[2-(2,4-ditert-butylphenoxy)acetyl]amino]benzamide |
| SMILES | CCC(C)NC(=O)c1ccccc1NC(=O)COc1ccc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C27H38N2O3/c1-9-18(2)28-25(31)20-12-10-11-13-22(20)29-24(30)17-32-23-15-14-19(26(3,4)5)16-21(23)27(6,7)8/h10-16,18H,9,17H2,1-8H3,(H,28,31)(H,29,30) |
| InChIKey | XIPAEJQIJSQWGS-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |