C26H38N2O4S — CID 17160244
N-[4-(butan-2-ylsulfamoyl)phenyl]-2-(2,4-ditert-butylphenoxy)acetamide (PubChem CID 17160244) has the molecular formula C26H38N2O4S and a molecular weight of 474.67 g/mol. Its IUPAC name is N-[4-(butan-2-ylsulfamoyl)phenyl]-2-(2,4-ditert-butylphenoxy)acetamide.
| Compound Name | N-[4-(butan-2-ylsulfamoyl)phenyl]-2-(2,4-ditert-butylphenoxy)acetamide |
|---|---|
| PubChem CID | 17160244 |
| Molecular Formula | C26H38N2O4S |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | N-[4-(butan-2-ylsulfamoyl)phenyl]-2-(2,4-ditert-butylphenoxy)acetamide |
| SMILES | CCC(C)NS(=O)(=O)c1ccc(NC(=O)COc2ccc(C(C)(C)C)cc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H38N2O4S/c1-9-18(2)28-33(30,31)21-13-11-20(12-14-21)27-24(29)17-32-23-15-10-19(25(3,4)5)16-22(23)26(6,7)8/h10-16,18,28H,9,17H2,1-8H3,(H,27,29) |
| InChIKey | WQCWNITYHJBHGG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |