C26H35NO4 — CID 17356495
propyl 4-[[2-(2,4-ditert-butylphenoxy)acetyl]amino]benzoate (PubChem CID 17356495) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is propyl 4-[[2-(2,4-ditert-butylphenoxy)acetyl]amino]benzoate.
| Compound Name | propyl 4-[[2-(2,4-ditert-butylphenoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 17356495 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | propyl 4-[[2-(2,4-ditert-butylphenoxy)acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)COc2ccc(C(C)(C)C)cc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H35NO4/c1-8-15-30-24(29)18-9-12-20(13-10-18)27-23(28)17-31-22-14-11-19(25(2,3)4)16-21(22)26(5,6)7/h9-14,16H,8,15,17H2,1-7H3,(H,27,28) |
| InChIKey | NBROFDSJZROYHD-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |