C23H26N3O4S+ — CID 5225702
2-(2-tert-butylphenoxy)-N-[4-(pyridin-1-ium-2-ylsulfamoyl)phenyl]acetamide (PubChem CID 5225702) has the molecular formula C23H26N3O4S+ and a molecular weight of 440.55 g/mol. Its IUPAC name is 2-(2-tert-butylphenoxy)-N-[4-(pyridin-1-ium-2-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(2-tert-butylphenoxy)-N-[4-(pyridin-1-ium-2-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 5225702 |
| Molecular Formula | C23H26N3O4S+ |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2-(2-tert-butylphenoxy)-N-[4-(pyridin-1-ium-2-ylsulfamoyl)phenyl]acetamide |
| SMILES | CC(C)(C)c1ccccc1OCC(=O)Nc1ccc(S(=O)(=O)Nc2cccc[nH+]2)cc1 |
| InChI | InChI=1S/C23H25N3O4S/c1-23(2,3)19-8-4-5-9-20(19)30-16-22(27)25-17-11-13-18(14-12-17)31(28,29)26-21-10-6-7-15-24-21/h4-15H,16H2,1-3H3,(H,24,26)(H,25,27)/p+1 |
| InChIKey | OTUMJFDBGYYBCE-UHFFFAOYSA-O |
| XLogP | 3.62 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |