C25H26N2O3 — CID 4935075
2-[[2-(2,4-dimethylphenoxy)acetyl]amino]-N-(1-phenylethyl)benzamide (PubChem CID 4935075) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is 2-[[2-(2,4-dimethylphenoxy)acetyl]amino]-N-(1-phenylethyl)benzamide.
| Compound Name | 2-[[2-(2,4-dimethylphenoxy)acetyl]amino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 4935075 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-[[2-(2,4-dimethylphenoxy)acetyl]amino]-N-(1-phenylethyl)benzamide |
| SMILES | Cc1ccc(OCC(=O)Nc2ccccc2C(=O)NC(C)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C25H26N2O3/c1-17-13-14-23(18(2)15-17)30-16-24(28)27-22-12-8-7-11-21(22)25(29)26-19(3)20-9-5-4-6-10-20/h4-15,19H,16H2,1-3H3,(H,26,29)(H,27,28) |
| InChIKey | MRRIMLJOGCNZGN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |