C22H19Br2NO3 — CID 17093492
2-(2,4-dibromo-6-methylphenoxy)-N-(2-phenylmethoxyphenyl)acetamide (PubChem CID 17093492) has the molecular formula C22H19Br2NO3 and a molecular weight of 505.21 g/mol. Its IUPAC name is 2-(2,4-dibromo-6-methylphenoxy)-N-(2-phenylmethoxyphenyl)acetamide.
| Compound Name | 2-(2,4-dibromo-6-methylphenoxy)-N-(2-phenylmethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 17093492 |
| Molecular Formula | C22H19Br2NO3 |
| Molecular Weight | 505.21 g/mol |
| Exact Mass | 502.97 |
| IUPAC Name | 2-(2,4-dibromo-6-methylphenoxy)-N-(2-phenylmethoxyphenyl)acetamide |
| SMILES | Cc1cc(Br)cc(Br)c1OCC(=O)Nc1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H19Br2NO3/c1-15-11-17(23)12-18(24)22(15)28-14-21(26)25-19-9-5-6-10-20(19)27-13-16-7-3-2-4-8-16/h2-12H,13-14H2,1H3,(H,25,26) |
| InChIKey | PMAINQILNXIYPI-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.21 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |