C15H13Cl3N2O2 — CID 91689111
N-(2-amino-4-chlorophenyl)-2-(2,4-dichloro-6-methylphenoxy)acetamide (PubChem CID 91689111) has the molecular formula C15H13Cl3N2O2 and a molecular weight of 359.64 g/mol. Its IUPAC name is N-(2-amino-4-chlorophenyl)-2-(2,4-dichloro-6-methylphenoxy)acetamide.
| Compound Name | N-(2-amino-4-chlorophenyl)-2-(2,4-dichloro-6-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 91689111 |
| Molecular Formula | C15H13Cl3N2O2 |
| Molecular Weight | 359.64 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | N-(2-amino-4-chlorophenyl)-2-(2,4-dichloro-6-methylphenoxy)acetamide |
| SMILES | Cc1cc(Cl)cc(Cl)c1OCC(=O)Nc1ccc(Cl)cc1N |
| InChI | InChI=1S/C15H13Cl3N2O2/c1-8-4-10(17)5-11(18)15(8)22-7-14(21)20-13-3-2-9(16)6-12(13)19/h2-6H,7,19H2,1H3,(H,20,21) |
| InChIKey | ZAWMSSFWNYBZPU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.64 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|