C14H6Cl6N2O3 — CID 5107504
[2-(2,4-dichloroanilino)-2-oxoethyl] 3,4,5,6-tetrachloropyridine-2-carboxylate (PubChem CID 5107504) has the molecular formula C14H6Cl6N2O3 and a molecular weight of 462.93 g/mol. Its IUPAC name is [2-(2,4-dichloroanilino)-2-oxoethyl] 3,4,5,6-tetrachloropyridine-2-carboxylate.
| Compound Name | [2-(2,4-dichloroanilino)-2-oxoethyl] 3,4,5,6-tetrachloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 5107504 |
| Molecular Formula | C14H6Cl6N2O3 |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 459.85 |
| IUPAC Name | [2-(2,4-dichloroanilino)-2-oxoethyl] 3,4,5,6-tetrachloropyridine-2-carboxylate |
| SMILES | O=C(COC(=O)c1nc(Cl)c(Cl)c(Cl)c1Cl)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H6Cl6N2O3/c15-5-1-2-7(6(16)3-5)21-8(23)4-25-14(24)12-10(18)9(17)11(19)13(20)22-12/h1-3H,4H2,(H,21,23) |
| InChIKey | OKQNIWPHEWXNND-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|