C14H9Cl4N3O5S — CID 2482620
[2-oxo-2-(4-sulfamoylanilino)ethyl] 3,4,5,6-tetrachloropyridine-2-carboxylate (PubChem CID 2482620) has the molecular formula C14H9Cl4N3O5S and a molecular weight of 473.12 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 3,4,5,6-tetrachloropyridine-2-carboxylate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 3,4,5,6-tetrachloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 2482620 |
| Molecular Formula | C14H9Cl4N3O5S |
| Molecular Weight | 473.12 g/mol |
| Exact Mass | 470.90 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 3,4,5,6-tetrachloropyridine-2-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COC(=O)c2nc(Cl)c(Cl)c(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C14H9Cl4N3O5S/c15-9-10(16)12(21-13(18)11(9)17)14(23)26-5-8(22)20-6-1-3-7(4-2-6)27(19,24)25/h1-4H,5H2,(H,20,22)(H2,19,24,25) |
| InChIKey | YDLRXGNNZCYEOA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.12 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|