C13H12N2O6S2 — CID 166201469
[2-oxo-2-(4-sulfamoylanilino)ethyl] 4-hydroxythiophene-2-carboxylate (PubChem CID 166201469) has the molecular formula C13H12N2O6S2 and a molecular weight of 356.38 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-hydroxythiophene-2-carboxylate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-hydroxythiophene-2-carboxylate |
|---|---|
| PubChem CID | 166201469 |
| Molecular Formula | C13H12N2O6S2 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-hydroxythiophene-2-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COC(=O)c2cc(O)cs2)cc1 |
| InChI | InChI=1S/C13H12N2O6S2/c14-23(19,20)10-3-1-8(2-4-10)15-12(17)6-21-13(18)11-5-9(16)7-22-11/h1-5,7,16H,6H2,(H,15,17)(H2,14,19,20) |
| InChIKey | INHQEKDWWSDNGO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|