C14H12ClN3O5S — CID 24524541
[2-oxo-2-(4-sulfamoylanilino)ethyl] 2-chloropyridine-4-carboxylate (PubChem CID 24524541) has the molecular formula C14H12ClN3O5S and a molecular weight of 369.79 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-chloropyridine-4-carboxylate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-chloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 24524541 |
| Molecular Formula | C14H12ClN3O5S |
| Molecular Weight | 369.79 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-chloropyridine-4-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COC(=O)c2ccnc(Cl)c2)cc1 |
| InChI | InChI=1S/C14H12ClN3O5S/c15-12-7-9(5-6-17-12)14(20)23-8-13(19)18-10-1-3-11(4-2-10)24(16,21)22/h1-7H,8H2,(H,18,19)(H2,16,21,22) |
| InChIKey | PFBHBGNIXQNKPI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.79 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|